About 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one
5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 55120005) has the molecular formula C12H12BrClN2O3
and a molecular weight of 347.60 g/mol. Its IUPAC name is 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 55120005 |
| Molecular Formula | C12H12BrClN2O3 |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(C(Cl)C3COCCO3)cc2[nH]1 |
| InChI | InChI=1S/C12H12BrClN2O3/c13-7-4-9-8(15-12(17)16-9)3-6(7)11(14)10-5-18-1-2-19-10/h3-4,10-11H,1-2,5H2,(H2,15,16,17) |
| InChIKey | YLXRDUSNIGXOBX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one (CID 55120005) is 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one is O=c1[nH]c2cc(Br)c(C(Cl)C3COCCO3)cc2[nH]1.
What is the InChIKey of 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one?
The InChIKey is YLXRDUSNIGXOBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClN2O3/c13-7-4-9-8(15-12(17)16-9)3-6(7)11(14)10-5-18-1-2-19-10/h3-4,10-11H,1-2,5H2,(H2,15,16,17).
What are the key properties of 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one?
5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one has a molecular weight of 347.60 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-[chloro(1,4-dioxan-2-yl)methyl]-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 55120005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).