C13H16N2O3S — CID 55120091
(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(1,4-dioxan-2-yl)methanone (PubChem CID 55120091) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(1,4-dioxan-2-yl)methanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 55120091 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(1,4-dioxan-2-yl)methanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)C1COCCO1)CCS2 |
| InChI | InChI=1S/C13H16N2O3S/c14-9-1-2-12-10(7-9)15(3-6-19-12)13(16)11-8-17-4-5-18-11/h1-2,7,11H,3-6,8,14H2 |
| InChIKey | WLKNQJMIXDHXHC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|