C10H15F3N2OS — CID 55120490
1-(4-methyl-1,3-thiazol-2-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 55120490) has the molecular formula C10H15F3N2OS and a molecular weight of 268.30 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 55120490 |
| Molecular Formula | C10H15F3N2OS |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | Cc1csc(CC(N)CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N2OS/c1-7-5-17-9(15-7)4-8(14)2-3-16-6-10(11,12)13/h5,8H,2-4,6,14H2,1H3 |
| InChIKey | SVLJTJWATDRXBX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|