C14H24N2S — CID 55121812
N',N'-dimethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butane-1,4-diamine (PubChem CID 55121812) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is N',N'-dimethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 55121812 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N',N'-dimethyl-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)butane-1,4-diamine |
| SMILES | CN(C)CCCCNC1CCCc2sccc21 |
| InChI | InChI=1S/C14H24N2S/c1-16(2)10-4-3-9-15-13-6-5-7-14-12(13)8-11-17-14/h8,11,13,15H,3-7,9-10H2,1-2H3 |
| InChIKey | VWTFJYDJRGUPSM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|