About 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine
2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine (PubChem CID 55123160) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine |
| PubChem CID | 55123160 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCC(C)c1nncn1C1CCCCC1 |
| InChI | InChI=1S/C13H24N4/c1-3-14-9-11(2)13-16-15-10-17(13)12-7-5-4-6-8-12/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | NTDHZZVMZDHNSD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine?
The IUPAC name of 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine (CID 55123160) is 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine.
What is the SMILES notation for 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine?
The canonical SMILES for 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine is CCNCC(C)c1nncn1C1CCCCC1.
What is the InChIKey of 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine?
The InChIKey is NTDHZZVMZDHNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-3-14-9-11(2)13-16-15-10-17(13)12-7-5-4-6-8-12/h10-12,14H,3-9H2,1-2H3.
What are the key properties of 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine?
2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine has a molecular weight of 236.36 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexyl-1,2,4-triazol-3-yl)-N-ethylpropan-1-amine is sourced from PubChem (CID 55123160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).