About 1-cyclopropylpentan-1-ol
1-cyclopropylpentan-1-ol (PubChem CID 551238) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is 1-cyclopropylpentan-1-ol.
Molecular Properties
| Compound Name | 1-cyclopropylpentan-1-ol |
| PubChem CID | 551238 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | 1-cyclopropylpentan-1-ol |
| SMILES | CCCCC(O)C1CC1 |
| InChI | InChI=1S/C8H16O/c1-2-3-4-8(9)7-5-6-7/h7-9H,2-6H2,1H3 |
| InChIKey | HCGLEGPQCCRMKF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpentan-1-ol?
The IUPAC name of 1-cyclopropylpentan-1-ol (CID 551238) is 1-cyclopropylpentan-1-ol.
What is the SMILES notation for 1-cyclopropylpentan-1-ol?
The canonical SMILES for 1-cyclopropylpentan-1-ol is CCCCC(O)C1CC1.
What is the InChIKey of 1-cyclopropylpentan-1-ol?
The InChIKey is HCGLEGPQCCRMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O/c1-2-3-4-8(9)7-5-6-7/h7-9H,2-6H2,1H3.
What are the key properties of 1-cyclopropylpentan-1-ol?
1-cyclopropylpentan-1-ol has a molecular weight of 128.21 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpentan-1-ol is sourced from PubChem (CID 551238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).