About 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid (PubChem CID 55124071) has the molecular formula C9H14N4O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid |
| PubChem CID | 55124071 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)c1nonc1N)C(C)(C)C(=O)O |
| InChI | InChI=1S/C9H14N4O4/c1-4-13(9(2,3)8(15)16)7(14)5-6(10)12-17-11-5/h4H2,1-3H3,(H2,10,12)(H,15,16) |
| InChIKey | DCLHCHSTZIFPOB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid?
The IUPAC name of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid (CID 55124071) is 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid?
The canonical SMILES for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid is CCN(C(=O)c1nonc1N)C(C)(C)C(=O)O.
What is the InChIKey of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid?
The InChIKey is DCLHCHSTZIFPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O4/c1-4-13(9(2,3)8(15)16)7(14)5-6(10)12-17-11-5/h4H2,1-3H3,(H2,10,12)(H,15,16).
What are the key properties of 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid?
2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid has a molecular weight of 242.23 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-1,2,5-oxadiazole-3-carbonyl)-ethylamino]-2-methylpropanoic acid is sourced from PubChem (CID 55124071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).