About 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine
2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine (PubChem CID 55124121) has the molecular formula C10H6ClF2N3O2
and a molecular weight of 273.63 g/mol. Its IUPAC name is 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine |
| PubChem CID | 55124121 |
| Molecular Formula | C10H6ClF2N3O2 |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(Oc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C10H6ClF2N3O2/c1-17-9-14-8(11)15-10(16-9)18-5-2-3-6(12)7(13)4-5/h2-4H,1H3 |
| InChIKey | WSMHIVQTTGUBOJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine?
The IUPAC name of 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine (CID 55124121) is 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine is COc1nc(Cl)nc(Oc2ccc(F)c(F)c2)n1.
What is the InChIKey of 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine?
The InChIKey is WSMHIVQTTGUBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClF2N3O2/c1-17-9-14-8(11)15-10(16-9)18-5-2-3-6(12)7(13)4-5/h2-4H,1H3.
What are the key properties of 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine?
2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine has a molecular weight of 273.63 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(3,4-difluorophenoxy)-6-methoxy-1,3,5-triazine is sourced from PubChem (CID 55124121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).