About 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine
1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine (PubChem CID 55124214) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine |
| PubChem CID | 55124214 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCCCc1nnc(C(CC)NCCC)o1 |
| InChI | InChI=1S/C13H25N3O/c1-4-7-8-9-12-15-16-13(17-12)11(6-3)14-10-5-2/h11,14H,4-10H2,1-3H3 |
| InChIKey | DEHKELNXFJQZSY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine?
The IUPAC name of 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine (CID 55124214) is 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine.
What is the SMILES notation for 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine?
The canonical SMILES for 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine is CCCCCc1nnc(C(CC)NCCC)o1.
What is the InChIKey of 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine?
The InChIKey is DEHKELNXFJQZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-4-7-8-9-12-15-16-13(17-12)11(6-3)14-10-5-2/h11,14H,4-10H2,1-3H3.
What are the key properties of 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine?
1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine has a molecular weight of 239.36 g/mol, XLogP of 3.25, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-pentyl-1,3,4-oxadiazol-2-yl)-N-propylpropan-1-amine is sourced from PubChem (CID 55124214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).