C13H14Cl2N4 — CID 55124467
N-benzyl-4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine (PubChem CID 55124467) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is N-benzyl-4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine.
| Compound Name | N-benzyl-4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 55124467 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-benzyl-4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine |
| SMILES | CC(C)N(Cc1ccccc1)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C13H14Cl2N4/c1-9(2)19(8-10-6-4-3-5-7-10)13-17-11(14)16-12(15)18-13/h3-7,9H,8H2,1-2H3 |
| InChIKey | VDDFFCVGMDFRLP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |