About oxolan-2-ylmethyl hexanoate
oxolan-2-ylmethyl hexanoate (PubChem CID 551247) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is oxolan-2-ylmethyl hexanoate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl hexanoate |
| PubChem CID | 551247 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | oxolan-2-ylmethyl hexanoate |
| SMILES | CCCCCC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C11H20O3/c1-2-3-4-7-11(12)14-9-10-6-5-8-13-10/h10H,2-9H2,1H3 |
| InChIKey | MPPBOQJASAOROU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze oxolan-2-ylmethyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl hexanoate?
The IUPAC name of oxolan-2-ylmethyl hexanoate (CID 551247) is oxolan-2-ylmethyl hexanoate.
What is the SMILES notation for oxolan-2-ylmethyl hexanoate?
The canonical SMILES for oxolan-2-ylmethyl hexanoate is CCCCCC(=O)OCC1CCCO1.
What is the InChIKey of oxolan-2-ylmethyl hexanoate?
The InChIKey is MPPBOQJASAOROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-3-4-7-11(12)14-9-10-6-5-8-13-10/h10H,2-9H2,1H3.
What are the key properties of oxolan-2-ylmethyl hexanoate?
oxolan-2-ylmethyl hexanoate has a molecular weight of 200.28 g/mol, XLogP of 2.29, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl hexanoate is sourced from PubChem (CID 551247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).