C13H15BrN4O — CID 55125969
2-bromo-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]butanamide (PubChem CID 55125969) has the molecular formula C13H15BrN4O and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-bromo-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]butanamide.
| Compound Name | 2-bromo-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 55125969 |
| Molecular Formula | C13H15BrN4O |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-bromo-N-[3-(4-methyl-1,2,4-triazol-3-yl)phenyl]butanamide |
| SMILES | CCC(Br)C(=O)Nc1cccc(-c2nncn2C)c1 |
| InChI | InChI=1S/C13H15BrN4O/c1-3-11(14)13(19)16-10-6-4-5-9(7-10)12-17-15-8-18(12)2/h4-8,11H,3H2,1-2H3,(H,16,19) |
| InChIKey | QYDNAOUNZXSQJN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|