C16H24N2O — CID 55126978
N-butyl-N-ethyl-1,2,3,4-tetrahydroquinoline-5-carboxamide (PubChem CID 55126978) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-butyl-N-ethyl-1,2,3,4-tetrahydroquinoline-5-carboxamide.
| Compound Name | N-butyl-N-ethyl-1,2,3,4-tetrahydroquinoline-5-carboxamide |
|---|---|
| PubChem CID | 55126978 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-butyl-N-ethyl-1,2,3,4-tetrahydroquinoline-5-carboxamide |
| SMILES | CCCCN(CC)C(=O)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C16H24N2O/c1-3-5-12-18(4-2)16(19)14-8-6-10-15-13(14)9-7-11-17-15/h6,8,10,17H,3-5,7,9,11-12H2,1-2H3 |
| InChIKey | WNSVACYVAQRMJZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |