About 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine
2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine (PubChem CID 55127312) has the molecular formula C12H7BrCl2FNO
and a molecular weight of 351.00 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine.
Molecular Properties
| Compound Name | 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine |
| PubChem CID | 55127312 |
| Molecular Formula | C12H7BrCl2FNO |
| Molecular Weight | 351.00 g/mol |
| Exact Mass | 348.91 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine |
| SMILES | Fc1cc(Br)ccc1OCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H7BrCl2FNO/c13-7-1-3-11(9(16)5-7)18-6-10-8(14)2-4-12(15)17-10/h1-5H,6H2 |
| InChIKey | MASNQMCIKBBBFE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.00 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine?
The IUPAC name of 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine (CID 55127312) is 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine.
What is the SMILES notation for 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine?
The canonical SMILES for 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine is Fc1cc(Br)ccc1OCc1nc(Cl)ccc1Cl.
What is the InChIKey of 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine?
The InChIKey is MASNQMCIKBBBFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrCl2FNO/c13-7-1-3-11(9(16)5-7)18-6-10-8(14)2-4-12(15)17-10/h1-5H,6H2.
What are the key properties of 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine?
2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine has a molecular weight of 351.00 g/mol, XLogP of 4.87, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2-fluorophenoxy)methyl]-3,6-dichloropyridine is sourced from PubChem (CID 55127312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).