C12H7Cl2F2NS — CID 55127363
3,6-dichloro-2-[(2,4-difluorophenyl)sulfanylmethyl]pyridine (PubChem CID 55127363) has the molecular formula C12H7Cl2F2NS and a molecular weight of 306.16 g/mol. Its IUPAC name is 3,6-dichloro-2-[(2,4-difluorophenyl)sulfanylmethyl]pyridine.
| Compound Name | 3,6-dichloro-2-[(2,4-difluorophenyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 55127363 |
| Molecular Formula | C12H7Cl2F2NS |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 3,6-dichloro-2-[(2,4-difluorophenyl)sulfanylmethyl]pyridine |
| SMILES | Fc1ccc(SCc2nc(Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C12H7Cl2F2NS/c13-8-2-4-12(14)17-10(8)6-18-11-3-1-7(15)5-9(11)16/h1-5H,6H2 |
| InChIKey | DMYDLERDKYDGCE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|