C10H11ClF4N2O — CID 55127550
5-chloro-N-methyl-6-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine (PubChem CID 55127550) has the molecular formula C10H11ClF4N2O and a molecular weight of 286.66 g/mol. Its IUPAC name is 5-chloro-N-methyl-6-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine.
| Compound Name | 5-chloro-N-methyl-6-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 55127550 |
| Molecular Formula | C10H11ClF4N2O |
| Molecular Weight | 286.66 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-chloro-N-methyl-6-(2,2,3,3-tetrafluoropropoxymethyl)pyridin-2-amine |
| SMILES | CNc1ccc(Cl)c(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H11ClF4N2O/c1-16-8-3-2-6(11)7(17-8)4-18-5-10(14,15)9(12)13/h2-3,9H,4-5H2,1H3,(H,16,17) |
| InChIKey | AGSCQOCMROINHT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.66 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|