About [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine
[5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine (PubChem CID 55127598) has the molecular formula C12H10ClF2N3O
and a molecular weight of 285.68 g/mol. Its IUPAC name is [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine.
Molecular Properties
| Compound Name | [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine |
| PubChem CID | 55127598 |
| Molecular Formula | C12H10ClF2N3O |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc(Cl)c(COc2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C12H10ClF2N3O/c13-8-2-4-12(18-16)17-11(8)6-19-7-1-3-9(14)10(15)5-7/h1-5H,6,16H2,(H,17,18) |
| InChIKey | QCLHVGHVTKYFGB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine?
The IUPAC name of [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine (CID 55127598) is [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine.
What is the SMILES notation for [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine?
The canonical SMILES for [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine is NNc1ccc(Cl)c(COc2ccc(F)c(F)c2)n1.
What is the InChIKey of [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine?
The InChIKey is QCLHVGHVTKYFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClF2N3O/c13-8-2-4-12(18-16)17-11(8)6-19-7-1-3-9(14)10(15)5-7/h1-5H,6,16H2,(H,17,18).
What are the key properties of [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine?
[5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine has a molecular weight of 285.68 g/mol, XLogP of 2.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-6-[(3,4-difluorophenoxy)methyl]-2-pyridinyl]hydrazine is sourced from PubChem (CID 55127598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).