C11H13Cl2F3N2 — CID 55127728
N-[(3,6-dichloro-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine (PubChem CID 55127728) has the molecular formula C11H13Cl2F3N2 and a molecular weight of 301.14 g/mol. Its IUPAC name is N-[(3,6-dichloro-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine.
| Compound Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
|---|---|
| PubChem CID | 55127728 |
| Molecular Formula | C11H13Cl2F3N2 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-[(3,6-dichloro-2-pyridinyl)methyl]-N-(2,2,2-trifluoroethyl)propan-1-amine |
| SMILES | CCCN(Cc1nc(Cl)ccc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C11H13Cl2F3N2/c1-2-5-18(7-11(14,15)16)6-9-8(12)3-4-10(13)17-9/h3-4H,2,5-7H2,1H3 |
| InChIKey | PAYVSSWPXGPUKO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|