About 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole
5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole (PubChem CID 55127836) has the molecular formula C12H12Cl2N2OS
and a molecular weight of 303.21 g/mol. Its IUPAC name is 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole |
| PubChem CID | 55127836 |
| Molecular Formula | C12H12Cl2N2OS |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCOCc1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2N2OS/c1-8-11(18-7-15-8)4-5-17-6-10-9(13)2-3-12(14)16-10/h2-3,7H,4-6H2,1H3 |
| InChIKey | KCJPQEVXSUBVMT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole?
The IUPAC name of 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole (CID 55127836) is 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole?
The canonical SMILES for 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole is Cc1ncsc1CCOCc1nc(Cl)ccc1Cl.
What is the InChIKey of 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole?
The InChIKey is KCJPQEVXSUBVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2OS/c1-8-11(18-7-15-8)4-5-17-6-10-9(13)2-3-12(14)16-10/h2-3,7H,4-6H2,1H3.
What are the key properties of 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole?
5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole has a molecular weight of 303.21 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(3,6-dichloro-2-pyridinyl)methoxy]ethyl]-4-methyl-1,3-thiazole is sourced from PubChem (CID 55127836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).