C20H40O — CID 551282
3,5,11,15-tetramethylhexadec-1-en-3-ol (PubChem CID 551282) has the molecular formula C20H40O and a molecular weight of 296.54 g/mol. Its IUPAC name is 3,5,11,15-tetramethylhexadec-1-en-3-ol.
| Compound Name | 3,5,11,15-tetramethylhexadec-1-en-3-ol |
|---|---|
| PubChem CID | 551282 |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.31 |
| IUPAC Name | 3,5,11,15-tetramethylhexadec-1-en-3-ol |
| SMILES | C=CC(C)(O)CC(C)CCCCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H40O/c1-7-20(6,21)16-19(5)14-10-8-9-13-18(4)15-11-12-17(2)3/h7,17-19,21H,1,8-16H2,2-6H3 |
| InChIKey | IOLVAUYSSNEWQQ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|