C12H23N3O3 — CID 55128241
2-[[2-[(dimethylamino)methyl]pyrrolidine-1-carbonyl]amino]-2-methylpropanoic acid (PubChem CID 55128241) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[[2-[(dimethylamino)methyl]pyrrolidine-1-carbonyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[[2-[(dimethylamino)methyl]pyrrolidine-1-carbonyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 55128241 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-[[2-[(dimethylamino)methyl]pyrrolidine-1-carbonyl]amino]-2-methylpropanoic acid |
| SMILES | CN(C)CC1CCCN1C(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C12H23N3O3/c1-12(2,10(16)17)13-11(18)15-7-5-6-9(15)8-14(3)4/h9H,5-8H2,1-4H3,(H,13,18)(H,16,17) |
| InChIKey | MKYZVSPCLKEUHI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |