C10H18N4O3S — CID 55129132
2-amino-2-methyl-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid (PubChem CID 55129132) has the molecular formula C10H18N4O3S and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-amino-2-methyl-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid.
| Compound Name | 2-amino-2-methyl-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 55129132 |
| Molecular Formula | C10H18N4O3S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-amino-2-methyl-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
| SMILES | Cn1c(SCCCCC(C)(N)C(=O)O)n[nH]c1=O |
| InChI | InChI=1S/C10H18N4O3S/c1-10(11,7(15)16)5-3-4-6-18-9-13-12-8(17)14(9)2/h3-6,11H2,1-2H3,(H,12,17)(H,15,16) |
| InChIKey | OTGWZJGBUKQUPY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|