C11H12F2N4OS — CID 55129278
3-(6-amino-2,3-difluorophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 55129278) has the molecular formula C11H12F2N4OS and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-(6-amino-2,3-difluorophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-(6-amino-2,3-difluorophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 55129278 |
| Molecular Formula | C11H12F2N4OS |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-(6-amino-2,3-difluorophenyl)sulfanyl-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(Sc2c(N)ccc(F)c2F)n[nH]c1=O |
| InChI | InChI=1S/C11H12F2N4OS/c1-5(2)17-10(18)15-16-11(17)19-9-7(14)4-3-6(12)8(9)13/h3-5H,14H2,1-2H3,(H,15,18) |
| InChIKey | DDGGSHLYOVFHQE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|