C13H17N5O — CID 55131641
3-amino-4-[(1-propan-2-ylpyrazol-4-yl)amino]benzamide (PubChem CID 55131641) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-amino-4-[(1-propan-2-ylpyrazol-4-yl)amino]benzamide.
| Compound Name | 3-amino-4-[(1-propan-2-ylpyrazol-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 55131641 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-amino-4-[(1-propan-2-ylpyrazol-4-yl)amino]benzamide |
| SMILES | CC(C)n1cc(Nc2ccc(C(N)=O)cc2N)cn1 |
| InChI | InChI=1S/C13H17N5O/c1-8(2)18-7-10(6-16-18)17-12-4-3-9(13(15)19)5-11(12)14/h3-8,17H,14H2,1-2H3,(H2,15,19) |
| InChIKey | MICREUOSYGPWFI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|