C13H22N2O2S — CID 55131989
2-methoxy-N-[[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methyl]ethanamine (PubChem CID 55131989) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 55131989 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-methoxy-N-[[4-(1,3-thiazol-4-ylmethyl)oxan-4-yl]methyl]ethanamine |
| SMILES | COCCNCC1(Cc2cscn2)CCOCC1 |
| InChI | InChI=1S/C13H22N2O2S/c1-16-7-4-14-10-13(2-5-17-6-3-13)8-12-9-18-11-15-12/h9,11,14H,2-8,10H2,1H3 |
| InChIKey | AGSUPWXWJBDBDV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|