About 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine
5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine (PubChem CID 55132577) has the molecular formula C14H17BrN4
and a molecular weight of 321.22 g/mol. Its IUPAC name is 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine |
| PubChem CID | 55132577 |
| Molecular Formula | C14H17BrN4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ncc(-c2ccc(Br)cc2)c(N)n1 |
| InChI | InChI=1S/C14H17BrN4/c1-3-19(4-2)14-17-9-12(13(16)18-14)10-5-7-11(15)8-6-10/h5-9H,3-4H2,1-2H3,(H2,16,17,18) |
| InChIKey | OUFQYGIAYOJWKO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine?
The IUPAC name of 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine (CID 55132577) is 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine is CCN(CC)c1ncc(-c2ccc(Br)cc2)c(N)n1.
What is the InChIKey of 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine?
The InChIKey is OUFQYGIAYOJWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrN4/c1-3-19(4-2)14-17-9-12(13(16)18-14)10-5-7-11(15)8-6-10/h5-9H,3-4H2,1-2H3,(H2,16,17,18).
What are the key properties of 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine?
5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine has a molecular weight of 321.22 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-2-N,2-N-diethylpyrimidine-2,4-diamine is sourced from PubChem (CID 55132577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).