C12H22N4O3 — CID 55133581
N,N-bis(2-amino-2-oxoethyl)-3-piperidin-3-ylpropanamide (PubChem CID 55133581) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-3-piperidin-3-ylpropanamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-3-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 55133581 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-3-piperidin-3-ylpropanamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)CCC1CCCNC1 |
| InChI | InChI=1S/C12H22N4O3/c13-10(17)7-16(8-11(14)18)12(19)4-3-9-2-1-5-15-6-9/h9,15H,1-8H2,(H2,13,17)(H2,14,18) |
| InChIKey | CZHHFOYGNVHCPU-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |