C12H14ClF3O — CID 55134945
1-(1-chloro-3,3,3-trifluoropropyl)-4-(2-methoxyethyl)benzene (PubChem CID 55134945) has the molecular formula C12H14ClF3O and a molecular weight of 266.69 g/mol. Its IUPAC name is 1-(1-chloro-3,3,3-trifluoropropyl)-4-(2-methoxyethyl)benzene.
| Compound Name | 1-(1-chloro-3,3,3-trifluoropropyl)-4-(2-methoxyethyl)benzene |
|---|---|
| PubChem CID | 55134945 |
| Molecular Formula | C12H14ClF3O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 1-(1-chloro-3,3,3-trifluoropropyl)-4-(2-methoxyethyl)benzene |
| SMILES | COCCc1ccc(C(Cl)CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14ClF3O/c1-17-7-6-9-2-4-10(5-3-9)11(13)8-12(14,15)16/h2-5,11H,6-8H2,1H3 |
| InChIKey | PGEGCOJUGNNFFL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|