About N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine
N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine (PubChem CID 55135116) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine.
Molecular Properties
| Compound Name | N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine |
| PubChem CID | 55135116 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine |
| SMILES | CCNCC1CC12Cc1ccccc1C2 |
| InChI | InChI=1S/C14H19N/c1-2-15-10-13-9-14(13)7-11-5-3-4-6-12(11)8-14/h3-6,13,15H,2,7-10H2,1H3 |
| InChIKey | BKEZWRVLXPMKAC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine?
The IUPAC name of N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine (CID 55135116) is N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine.
What is the SMILES notation for N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine?
The canonical SMILES for N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine is CCNCC1CC12Cc1ccccc1C2.
What is the InChIKey of N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine?
The InChIKey is BKEZWRVLXPMKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-15-10-13-9-14(13)7-11-5-3-4-6-12(11)8-14/h3-6,13,15H,2,7-10H2,1H3.
What are the key properties of N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine?
N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine has a molecular weight of 201.31 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(spiro[1,3-dihydroindene-2,2'-cyclopropane]-1'-ylmethyl)ethanamine is sourced from PubChem (CID 55135116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).