About 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide
3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide (PubChem CID 55136561) has the molecular formula C9H19N3O4
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide.
Molecular Properties
| Compound Name | 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide |
| PubChem CID | 55136561 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCOC)C(=O)CC(N)=NO |
| InChI | InChI=1S/C9H19N3O4/c1-15-5-3-12(4-6-16-2)9(13)7-8(10)11-14/h14H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | FCZQCOXQMZDLHY-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide?
The IUPAC name of 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide (CID 55136561) is 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide.
What is the SMILES notation for 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide?
The canonical SMILES for 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide is COCCN(CCOC)C(=O)CC(N)=NO.
What is the InChIKey of 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide?
The InChIKey is FCZQCOXQMZDLHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O4/c1-15-5-3-12(4-6-16-2)9(13)7-8(10)11-14/h14H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide?
3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide has a molecular weight of 233.27 g/mol, XLogP of -0.76, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-hydroxyimino-N,N-bis(2-methoxyethyl)propanamide is sourced from PubChem (CID 55136561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).