C10H18N4 — CID 55136696
(5-ethyl-6-methyl-2-propan-2-ylpyrimidin-4-yl)hydrazine (PubChem CID 55136696) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (5-ethyl-6-methyl-2-propan-2-ylpyrimidin-4-yl)hydrazine.
| Compound Name | (5-ethyl-6-methyl-2-propan-2-ylpyrimidin-4-yl)hydrazine |
|---|---|
| PubChem CID | 55136696 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (5-ethyl-6-methyl-2-propan-2-ylpyrimidin-4-yl)hydrazine |
| SMILES | CCc1c(C)nc(C(C)C)nc1NN |
| InChI | InChI=1S/C10H18N4/c1-5-8-7(4)12-9(6(2)3)13-10(8)14-11/h6H,5,11H2,1-4H3,(H,12,13,14) |
| InChIKey | LAEAXBTYBMWHND-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|