C18H26F7NO5 — CID 551367
bis(3-methylbutyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)butanedioate (PubChem CID 551367) has the molecular formula C18H26F7NO5 and a molecular weight of 469.39 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)butanedioate.
| Compound Name | bis(3-methylbutyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)butanedioate |
|---|---|
| PubChem CID | 551367 |
| Molecular Formula | C18H26F7NO5 |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | bis(3-methylbutyl) 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)butanedioate |
| SMILES | CC(C)CCOC(=O)CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(C)C |
| InChI | InChI=1S/C18H26F7NO5/c1-10(2)5-7-30-13(27)9-12(14(28)31-8-6-11(3)4)26-15(29)16(19,20)17(21,22)18(23,24)25/h10-12H,5-9H2,1-4H3,(H,26,29) |
| InChIKey | VIFUJIXWSIVXKN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|