About N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide
N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 55137342) has the molecular formula C7H11N7O
and a molecular weight of 209.21 g/mol. Its IUPAC name is N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 55137342 |
| Molecular Formula | C7H11N7O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)NCCN=[N+]=[N-])n1cncn1 |
| InChI | InChI=1S/C7H11N7O/c1-6(14-5-9-4-12-14)7(15)10-2-3-11-13-8/h4-6H,2-3H2,1H3,(H,10,15) |
| InChIKey | QDJAPKNROWSGSN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide (CID 55137342) is N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide is CC(C(=O)NCCN=[N+]=[N-])n1cncn1.
What is the InChIKey of N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is QDJAPKNROWSGSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N7O/c1-6(14-5-9-4-12-14)7(15)10-2-3-11-13-8/h4-6H,2-3H2,1H3,(H,10,15).
What are the key properties of N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide?
N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 209.21 g/mol, XLogP of 0.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-azidoethyl)-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 55137342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).