About 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile
3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile (PubChem CID 55139329) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile |
| PubChem CID | 55139329 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile |
| SMILES | Cc1nnc(NCC(C)(C)C)c(C#N)c1C |
| InChI | InChI=1S/C12H18N4/c1-8-9(2)15-16-11(10(8)6-13)14-7-12(3,4)5/h7H2,1-5H3,(H,14,16) |
| InChIKey | JQRMZHANWFKHSV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile?
The IUPAC name of 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile (CID 55139329) is 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile.
What is the SMILES notation for 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile?
The canonical SMILES for 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile is Cc1nnc(NCC(C)(C)C)c(C#N)c1C.
What is the InChIKey of 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile?
The InChIKey is JQRMZHANWFKHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-8-9(2)15-16-11(10(8)6-13)14-7-12(3,4)5/h7H2,1-5H3,(H,14,16).
What are the key properties of 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile?
3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile has a molecular weight of 218.30 g/mol, XLogP of 2.42, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropylamino)-5,6-dimethylpyridazine-4-carbonitrile is sourced from PubChem (CID 55139329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).