C10H13ClF3N3S — CID 55140387
4-(chloromethyl)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 55140387) has the molecular formula C10H13ClF3N3S and a molecular weight of 299.75 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 55140387 |
| Molecular Formula | C10H13ClF3N3S |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-(chloromethyl)-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | FC(F)(F)CN1CCN(c2nc(CCl)cs2)CC1 |
| InChI | InChI=1S/C10H13ClF3N3S/c11-5-8-6-18-9(15-8)17-3-1-16(2-4-17)7-10(12,13)14/h6H,1-5,7H2 |
| InChIKey | CPJLMFRJLWNPAJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|