C12H28N4O2S — CID 55142284
1-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-methylpropyl]pyrrolidine (PubChem CID 55142284) has the molecular formula C12H28N4O2S and a molecular weight of 292.45 g/mol. Its IUPAC name is 1-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-methylpropyl]pyrrolidine.
| Compound Name | 1-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-methylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 55142284 |
| Molecular Formula | C12H28N4O2S |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[3-[[3-aminopropyl(methyl)sulfamoyl]amino]-2-methylpropyl]pyrrolidine |
| SMILES | CC(CNS(=O)(=O)N(C)CCCN)CN1CCCC1 |
| InChI | InChI=1S/C12H28N4O2S/c1-12(11-16-8-3-4-9-16)10-14-19(17,18)15(2)7-5-6-13/h12,14H,3-11,13H2,1-2H3 |
| InChIKey | FMBXSASREJXQON-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |