About [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine
[3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine (PubChem CID 55142370) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 55142370 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine |
| SMILES | CN1CCC(CN)(N2Cc3ccccc3C2)C1 |
| InChI | InChI=1S/C14H21N3/c1-16-7-6-14(10-15,11-16)17-8-12-4-2-3-5-13(12)9-17/h2-5H,6-11,15H2,1H3 |
| InChIKey | PZKBHHSFSBOXNP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine (CID 55142370) is [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine is CN1CCC(CN)(N2Cc3ccccc3C2)C1.
What is the InChIKey of [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine?
The InChIKey is PZKBHHSFSBOXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-16-7-6-14(10-15,11-16)17-8-12-4-2-3-5-13(12)9-17/h2-5H,6-11,15H2,1H3.
What are the key properties of [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine?
[3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine has a molecular weight of 231.34 g/mol, XLogP of 1.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,3-dihydroisoindol-2-yl)-1-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 55142370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).