About N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide
N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide (PubChem CID 55143627) has the molecular formula C11H13F3N2OS
and a molecular weight of 278.30 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 55143627 |
| Molecular Formula | C11H13F3N2OS |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)c1cscn1 |
| InChI | InChI=1S/C11H13F3N2OS/c12-11(13,14)7-3-1-2-4-8(7)16-10(17)9-5-18-6-15-9/h5-8H,1-4H2,(H,16,17) |
| InChIKey | KYBIMQXINGTWSG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide (CID 55143627) is N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide is O=C(NC1CCCCC1C(F)(F)F)c1cscn1.
What is the InChIKey of N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide?
The InChIKey is KYBIMQXINGTWSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N2OS/c12-11(13,14)7-3-1-2-4-8(7)16-10(17)9-5-18-6-15-9/h5-8H,1-4H2,(H,16,17).
What are the key properties of N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide?
N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide has a molecular weight of 278.30 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(trifluoromethyl)cyclohexyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 55143627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).