C13H16N4 — CID 55144066
3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-4,5-dimethylaniline (PubChem CID 55144066) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-4,5-dimethylaniline.
| Compound Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-4,5-dimethylaniline |
|---|---|
| PubChem CID | 55144066 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)-4,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(-c2n[nH]c(C3CC3)n2)c1C |
| InChI | InChI=1S/C13H16N4/c1-7-5-10(14)6-11(8(7)2)13-15-12(16-17-13)9-3-4-9/h5-6,9H,3-4,14H2,1-2H3,(H,15,16,17) |
| InChIKey | WIPIAIKMHHNWDS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|