About 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid
4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid (PubChem CID 55144551) has the molecular formula C11H18N2O2S2
and a molecular weight of 274.41 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid.
Molecular Properties
| Compound Name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid |
| PubChem CID | 55144551 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid |
| SMILES | Cc1csc(SCCC(NC(C)C)C(=O)O)n1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-7(2)12-9(10(14)15)4-5-16-11-13-8(3)6-17-11/h6-7,9,12H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | AQCOSVOOHMHUAU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid?
The IUPAC name of 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid (CID 55144551) is 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid.
What is the SMILES notation for 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid?
The canonical SMILES for 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid is Cc1csc(SCCC(NC(C)C)C(=O)O)n1.
What is the InChIKey of 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid?
The InChIKey is AQCOSVOOHMHUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S2/c1-7(2)12-9(10(14)15)4-5-16-11-13-8(3)6-17-11/h6-7,9,12H,4-5H2,1-3H3,(H,14,15).
What are the key properties of 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid?
4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid has a molecular weight of 274.41 g/mol, XLogP of 2.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-2-(propan-2-ylamino)butanoic acid is sourced from PubChem (CID 55144551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).