About methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate
methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate (PubChem CID 55144890) has the molecular formula C10H19F3N2O2
and a molecular weight of 256.27 g/mol. Its IUPAC name is methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate.
Molecular Properties
| Compound Name | methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate |
| PubChem CID | 55144890 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate |
| SMILES | COC(=O)C(N)CCN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H19F3N2O2/c1-7(2)15(6-10(11,12)13)5-4-8(14)9(16)17-3/h7-8H,4-6,14H2,1-3H3 |
| InChIKey | WORFRVVMEXFNNJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate?
The IUPAC name of methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate (CID 55144890) is methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate.
What is the SMILES notation for methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate?
The canonical SMILES for methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate is COC(=O)C(N)CCN(CC(F)(F)F)C(C)C.
What is the InChIKey of methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate?
The InChIKey is WORFRVVMEXFNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2/c1-7(2)15(6-10(11,12)13)5-4-8(14)9(16)17-3/h7-8H,4-6,14H2,1-3H3.
What are the key properties of methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate?
methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate has a molecular weight of 256.27 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4-[propan-2-yl(2,2,2-trifluoroethyl)amino]butanoate is sourced from PubChem (CID 55144890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).