About 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide
4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide (PubChem CID 55145081) has the molecular formula C11H22F3N3O
and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide.
Molecular Properties
| Compound Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide |
| PubChem CID | 55145081 |
| Molecular Formula | C11H22F3N3O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide |
| SMILES | CCCNC(CCN(CC)CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C11H22F3N3O/c1-3-6-16-9(10(15)18)5-7-17(4-2)8-11(12,13)14/h9,16H,3-8H2,1-2H3,(H2,15,18) |
| InChIKey | BVDWQKPTAOFZEN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide?
The IUPAC name of 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide (CID 55145081) is 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide.
What is the SMILES notation for 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide?
The canonical SMILES for 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide is CCCNC(CCN(CC)CC(F)(F)F)C(N)=O.
What is the InChIKey of 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide?
The InChIKey is BVDWQKPTAOFZEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F3N3O/c1-3-6-16-9(10(15)18)5-7-17(4-2)8-11(12,13)14/h9,16H,3-8H2,1-2H3,(H2,15,18).
What are the key properties of 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide?
4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide has a molecular weight of 269.31 g/mol, XLogP of 1.11, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[ethyl(2,2,2-trifluoroethyl)amino]-2-(propylamino)butanamide is sourced from PubChem (CID 55145081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).