About 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine (PubChem CID 55145384) has the molecular formula C13H17N5
and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine |
| PubChem CID | 55145384 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine |
| SMILES | CNc1ncccc1CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C13H17N5/c1-14-13-11(3-2-4-16-13)9-17-7-8-18-6-5-15-12(18)10-17/h2-6H,7-10H2,1H3,(H,14,16) |
| InChIKey | ARUXGAJBORVIGJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine?
The IUPAC name of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine (CID 55145384) is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine.
What is the SMILES notation for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine?
The canonical SMILES for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine is CNc1ncccc1CN1CCn2ccnc2C1.
What is the InChIKey of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine?
The InChIKey is ARUXGAJBORVIGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5/c1-14-13-11(3-2-4-16-13)9-17-7-8-18-6-5-15-12(18)10-17/h2-6H,7-10H2,1H3,(H,14,16).
What are the key properties of 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine?
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine has a molecular weight of 243.31 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-N-methylpyridin-2-amine is sourced from PubChem (CID 55145384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).