C16H22OS — CID 551454
3,7-dimethyl-5-phenylsulfanylocta-1,6-dien-3-ol (PubChem CID 551454) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 3,7-dimethyl-5-phenylsulfanylocta-1,6-dien-3-ol.
| Compound Name | 3,7-dimethyl-5-phenylsulfanylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 551454 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3,7-dimethyl-5-phenylsulfanylocta-1,6-dien-3-ol |
| SMILES | C=CC(C)(O)CC(C=C(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C16H22OS/c1-5-16(4,17)12-15(11-13(2)3)18-14-9-7-6-8-10-14/h5-11,15,17H,1,12H2,2-4H3 |
| InChIKey | SREXZEBOGHIFIZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|