C13H13F3N2S — CID 55146785
(4-propan-2-yl-1,3-thiazol-2-yl)-(3,4,5-trifluorophenyl)methanamine (PubChem CID 55146785) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is (4-propan-2-yl-1,3-thiazol-2-yl)-(3,4,5-trifluorophenyl)methanamine.
| Compound Name | (4-propan-2-yl-1,3-thiazol-2-yl)-(3,4,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 55146785 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | (4-propan-2-yl-1,3-thiazol-2-yl)-(3,4,5-trifluorophenyl)methanamine |
| SMILES | CC(C)c1csc(C(N)c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H13F3N2S/c1-6(2)10-5-19-13(18-10)12(17)7-3-8(14)11(16)9(15)4-7/h3-6,12H,17H2,1-2H3 |
| InChIKey | HIEVXNBSNLQKDK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|