C13H20BrNO3 — CID 55147198
3-[2-bromo-4-[(2-methoxyethylamino)methyl]phenoxy]propan-1-ol (PubChem CID 55147198) has the molecular formula C13H20BrNO3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 3-[2-bromo-4-[(2-methoxyethylamino)methyl]phenoxy]propan-1-ol.
| Compound Name | 3-[2-bromo-4-[(2-methoxyethylamino)methyl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 55147198 |
| Molecular Formula | C13H20BrNO3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 3-[2-bromo-4-[(2-methoxyethylamino)methyl]phenoxy]propan-1-ol |
| SMILES | COCCNCc1ccc(OCCCO)c(Br)c1 |
| InChI | InChI=1S/C13H20BrNO3/c1-17-8-5-15-10-11-3-4-13(12(14)9-11)18-7-2-6-16/h3-4,9,15-16H,2,5-8,10H2,1H3 |
| InChIKey | FXNXINZMPRQTEV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|