About 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane
1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane (PubChem CID 55149225) has the molecular formula C13H18F2N2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane.
Molecular Properties
| Compound Name | 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane |
| PubChem CID | 55149225 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane |
| SMILES | CC1CCN(c2cccc(F)c2F)CCCN1 |
| InChI | InChI=1S/C13H18F2N2/c1-10-6-9-17(8-3-7-16-10)12-5-2-4-11(14)13(12)15/h2,4-5,10,16H,3,6-9H2,1H3 |
| InChIKey | KLUHEUXAAHENGI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane?
The IUPAC name of 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane (CID 55149225) is 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane.
What is the SMILES notation for 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane?
The canonical SMILES for 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane is CC1CCN(c2cccc(F)c2F)CCCN1.
What is the InChIKey of 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane?
The InChIKey is KLUHEUXAAHENGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N2/c1-10-6-9-17(8-3-7-16-10)12-5-2-4-11(14)13(12)15/h2,4-5,10,16H,3,6-9H2,1H3.
What are the key properties of 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane?
1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane has a molecular weight of 240.30 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-difluorophenyl)-4-methyl-1,5-diazocane is sourced from PubChem (CID 55149225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).