1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid

C11H18N2O5S — CID 55150453

IUPAC1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)NC2CCS(=O)(=O)CC2)C1
InChIInChI=1S/C11H18N2O5S/c14-10(15)8-1-4-13(7-8)11(16)12-9-2-5-19(17,18)6-3-9/h8-9H,1-7H2,(H,12,16)(H,14,15)
InChIKeyDXZRKBROZOCUAO-UHFFFAOYSA-N
MW290.34 g/mol
LogP-0.32
Rot. Bonds2

About 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid

1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 55150453) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid
PubChem CID55150453
Molecular FormulaC11H18N2O5S
Molecular Weight290.34 g/mol
Exact Mass290.09
IUPAC Name1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(C(=O)NC2CCS(=O)(=O)CC2)C1
InChIInChI=1S/C11H18N2O5S/c14-10(15)8-1-4-13(7-8)11(16)12-9-2-5-19(17,18)6-3-9/h8-9H,1-7H2,(H,12,16)(H,14,15)
InChIKeyDXZRKBROZOCUAO-UHFFFAOYSA-N
XLogP-0.32
TPSA103.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.34
LogP ≤ 5-0.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid (CID 55150453) is 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(C(=O)NC2CCS(=O)(=O)CC2)C1.
What is the InChIKey of 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid?
The InChIKey is DXZRKBROZOCUAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O5S/c14-10(15)8-1-4-13(7-8)11(16)12-9-2-5-19(17,18)6-3-9/h8-9H,1-7H2,(H,12,16)(H,14,15).
What are the key properties of 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid?
1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid has a molecular weight of 290.34 g/mol, XLogP of -0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxothian-4-yl)carbamoyl]pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 55150453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).