C9H10ClF3N2O3S — CID 55151330
methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-thiazole-5-carboxylate (PubChem CID 55151330) has the molecular formula C9H10ClF3N2O3S and a molecular weight of 318.70 g/mol. Its IUPAC name is methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 55151330 |
| Molecular Formula | C9H10ClF3N2O3S |
| Molecular Weight | 318.70 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | methyl 4-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NCCOCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C9H10ClF3N2O3S/c1-17-7(16)5-6(10)15-8(19-5)14-2-3-18-4-9(11,12)13/h2-4H2,1H3,(H,14,15) |
| InChIKey | PMGMFVCISWRPRH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|