About 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide
2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide (PubChem CID 55151969) has the molecular formula C10H21N3O3S
and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide.
Molecular Properties
| Compound Name | 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide |
| PubChem CID | 55151969 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide |
| SMILES | CCCCS(=O)(=O)NC1CCCC1/C(N)=N/O |
| InChI | InChI=1S/C10H21N3O3S/c1-2-3-7-17(15,16)13-9-6-4-5-8(9)10(11)12-14/h8-9,13-14H,2-7H2,1H3,(H2,11,12) |
| InChIKey | GFJDRCHLDIOJOI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide?
The IUPAC name of 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide (CID 55151969) is 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide.
What is the SMILES notation for 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide?
The canonical SMILES for 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide is CCCCS(=O)(=O)NC1CCCC1/C(N)=N/O.
What is the InChIKey of 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide?
The InChIKey is GFJDRCHLDIOJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O3S/c1-2-3-7-17(15,16)13-9-6-4-5-8(9)10(11)12-14/h8-9,13-14H,2-7H2,1H3,(H2,11,12).
What are the key properties of 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide?
2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide has a molecular weight of 263.36 g/mol, XLogP of 0.62, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butylsulfonylamino)-N'-hydroxycyclopentane-1-carboximidamide is sourced from PubChem (CID 55151969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).